C21H29F2IN4O2S — CID 111783892
1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111783892) has the molecular formula C21H29F2IN4O2S and a molecular weight of 566.46 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111783892 |
| Molecular Formula | C21H29F2IN4O2S |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCOc1ccc(F)cc1F.I |
| InChI | InChI=1S/C21H28F2N4O2S.HI/c1-2-24-21(25-7-10-29-19-6-5-16(22)14-17(19)23)26-15-18(20-4-3-13-30-20)27-8-11-28-12-9-27;/h3-6,13-14,18H,2,7-12,15H2,1H3,(H2,24,25,26);1H |
| InChIKey | JIOLKOOALSNXPD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|