C16H28N4OS — CID 111022177
1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111022177) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111022177 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C16H28N4OS/c1-4-17-16(19-12-15-6-5-14(3)22-15)18-11-13(2)20-7-9-21-10-8-20/h5-6,13H,4,7-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | JTKNLUUCJBIKAB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|