C20H30IN5O2 — CID 111022232
1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111022232) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111022232 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C20H29N5O2.HI/c1-3-21-20(22-14-16(2)25-9-11-26-12-10-25)23-15-18-13-19(27-24-18)17-7-5-4-6-8-17;/h4-8,13,16H,3,9-12,14-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ARCDOKLFBGHRMV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|