C19H22FIN4S — CID 111767364
2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111767364) has the molecular formula C19H22FIN4S and a molecular weight of 484.38 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111767364 |
| Molecular Formula | C19H22FIN4S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1F)NCCSc1ccccc1.I |
| InChI | InChI=1S/C19H21FN4S.HI/c1-2-22-19(23-10-11-25-17-6-4-3-5-7-17)24-14-16-9-8-15(13-21)12-18(16)20;/h3-9,12H,2,10-11,14H2,1H3,(H2,22,23,24);1H |
| InChIKey | YLDFPMDVYDOBJY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|