C20H30FN5 — CID 111767263
2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111767263) has the molecular formula C20H30FN5 and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111767263 |
| Molecular Formula | C20H30FN5 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1F)NCCCN1CCCCC1C |
| InChI | InChI=1S/C20H30FN5/c1-3-23-20(24-10-6-12-26-11-5-4-7-16(26)2)25-15-18-9-8-17(14-22)13-19(18)21/h8-9,13,16H,3-7,10-12,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | QXZROOQOIVPCCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|