C17H22FN5O — CID 111996581
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine (PubChem CID 111996581) has the molecular formula C17H22FN5O and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111996581 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C17H22FN5O/c1-3-20-17(22-14-5-7-16(24)23(2)11-14)21-10-13-8-12(9-19)4-6-15(13)18/h4,6,8,14H,3,5,7,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | NNHYAFJFOHFQBA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|