C23H25FN6 — CID 111996305
2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethylguanidine (PubChem CID 111996305) has the molecular formula C23H25FN6 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethylguanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111996305 |
| Molecular Formula | C23H25FN6 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC1CCCN(c2ccccc2C#N)C1 |
| InChI | InChI=1S/C23H25FN6/c1-2-27-23(28-15-19-12-17(13-25)9-10-21(19)24)29-20-7-5-11-30(16-20)22-8-4-3-6-18(22)14-26/h3-4,6,8-10,12,20H,2,5,7,11,15-16H2,1H3,(H2,27,28,29) |
| InChIKey | QYOJPYQEIIPSKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|