C23H30N6 — CID 109405933
1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109405933) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109405933 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccncc1C)NC1CCCN(c2ccccc2C#N)C1 |
| InChI | InChI=1S/C23H30N6/c1-3-26-23(27-13-11-19-10-12-25-16-18(19)2)28-21-8-6-14-29(17-21)22-9-5-4-7-20(22)15-24/h4-5,7,9-10,12,16,21H,3,6,8,11,13-14,17H2,1-2H3,(H2,26,27,28) |
| InChIKey | OGMUTZAJSRJCOJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|