C23H28N8 — CID 111995073
1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111995073) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111995073 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[1-(2-cyanophenyl)piperidin-3-yl]-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)NC1CCCN(c2ccccc2C#N)C1 |
| InChI | InChI=1S/C23H28N8/c1-2-25-23(26-13-12-22-29-28-21-11-5-6-15-31(21)22)27-19-9-7-14-30(17-19)20-10-4-3-8-18(20)16-24/h3-6,8,10-11,15,19H,2,7,9,12-14,17H2,1H3,(H2,25,26,27) |
| InChIKey | YUTZBGPMBDDBTJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|