C17H25F3IN3O2 — CID 111735176
N-ethyl-3-(methoxymethyl)-N'-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111735176) has the molecular formula C17H25F3IN3O2 and a molecular weight of 487.30 g/mol. Its IUPAC name is N-ethyl-3-(methoxymethyl)-N'-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(methoxymethyl)-N'-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111735176 |
| Molecular Formula | C17H25F3IN3O2 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-ethyl-3-(methoxymethyl)-N'-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)N1CCC(COC)C1.I |
| InChI | InChI=1S/C17H24F3N3O2.HI/c1-3-21-16(23-9-8-13(11-23)12-24-2)22-10-14-6-4-5-7-15(14)25-17(18,19)20;/h4-7,13H,3,8-12H2,1-2H3,(H,21,22);1H |
| InChIKey | PCSZJTYCJKCXAV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|