C17H25BrF2IN3O2 — CID 111735246
N'-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111735246) has the molecular formula C17H25BrF2IN3O2 and a molecular weight of 548.21 g/mol. Its IUPAC name is N'-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111735246 |
| Molecular Formula | C17H25BrF2IN3O2 |
| Molecular Weight | 548.21 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | N'-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)ccc1OC(F)F)N1CCC(COC)C1.I |
| InChI | InChI=1S/C17H24BrF2N3O2.HI/c1-3-21-17(23-7-6-12(10-23)11-24-2)22-9-13-8-14(18)4-5-15(13)25-16(19)20;/h4-5,8,12,16H,3,6-7,9-11H2,1-2H3,(H,21,22);1H |
| InChIKey | DAQCLKKLDLQRDC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|