C16H24BrN3O — CID 111978372
N'-[(4-bromophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111978372) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is N'-[(4-bromophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(4-bromophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111978372 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N'-[(4-bromophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1)N1CCC(COC)C1 |
| InChI | InChI=1S/C16H24BrN3O/c1-3-18-16(20-9-8-14(11-20)12-21-2)19-10-13-4-6-15(17)7-5-13/h4-7,14H,3,8-12H2,1-2H3,(H,18,19) |
| InChIKey | VQRCAPMOSFRVNT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|