C20H41IN6OS — CID 111710950
1-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111710950) has the molecular formula C20H41IN6OS and a molecular weight of 540.56 g/mol. Its IUPAC name is 1-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111710950 |
| Molecular Formula | C20H41IN6OS |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)NCCCc1nnc(SC)n1CC(C)C.I |
| InChI | InChI=1S/C20H40N6OS.HI/c1-9-21-18(23-13-16(27-7)20(4,5)6)22-12-10-11-17-24-25-19(28-8)26(17)14-15(2)3;/h15-16H,9-14H2,1-8H3,(H2,21,22,23);1H |
| InChIKey | ITPXRILPSQKLOW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|