C21H34FIN6S — CID 111362582
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111362582) has the molecular formula C21H34FIN6S and a molecular weight of 548.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111362582 |
| Molecular Formula | C21H34FIN6S |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1CC(C)C)NCCc1ccccc1F.I |
| InChI | InChI=1S/C21H33FN6S.HI/c1-5-23-20(25-14-12-17-9-6-7-10-18(17)22)24-13-8-11-19-26-27-21(29-4)28(19)15-16(2)3;/h6-7,9-10,16H,5,8,11-15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | NQCVLLFBRDMSSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|