C21H33FN6S — CID 111396159
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111396159) has the molecular formula C21H33FN6S and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111396159 |
| Molecular Formula | C21H33FN6S |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1CC(C)C)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C21H33FN6S/c1-5-23-20(25-13-11-17-8-6-9-18(22)14-17)24-12-7-10-19-26-27-21(29-4)28(19)15-16(2)3/h6,8-9,14,16H,5,7,10-13,15H2,1-4H3,(H2,23,24,25) |
| InChIKey | QYWOWTCCMQHEGM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|