C19H35N5O — CID 111712384
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111712384) has the molecular formula C19H35N5O and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111712384 |
| Molecular Formula | C19H35N5O |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C19H35N5O/c1-3-9-17(11-15-25)16-24-19(20-4-2)23-14-8-7-13-22-18-10-5-6-12-21-18/h5-6,10,12,17,25H,3-4,7-9,11,13-16H2,1-2H3,(H,21,22)(H2,20,23,24) |
| InChIKey | PKJMMRHAFZRXMH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|