C22H33IN4O4 — CID 111661983
N-[2-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide (PubChem CID 111661983) has the molecular formula C22H33IN4O4 and a molecular weight of 544.43 g/mol. Its IUPAC name is N-[2-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111661983 |
| Molecular Formula | C22H33IN4O4 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[2-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCNC(=O)c1cccc(OC)c1.I |
| InChI | InChI=1S/C22H32N4O4.HI/c1-6-23-21(26-14-22(4,28)19-12-15(2)30-16(19)3)25-11-10-24-20(27)17-8-7-9-18(13-17)29-5;/h7-9,12-13,28H,6,10-11,14H2,1-5H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | UNBNNLPUQMJMCM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|