C23H35N3O4 — CID 111660659
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine (PubChem CID 111660659) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine |
|---|---|
| PubChem CID | 111660659 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H35N3O4/c1-6-24-22(26-16-23(4,27)21-14-17(2)30-18(21)3)25-12-7-13-29-15-19-8-10-20(28-5)11-9-19/h8-11,14,27H,6-7,12-13,15-16H2,1-5H3,(H2,24,25,26) |
| InChIKey | IITYIJFCEIXOLE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|