C18H26IN3O4S — CID 111672941
1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111672941) has the molecular formula C18H26IN3O4S and a molecular weight of 507.39 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672941 |
| Molecular Formula | C18H26IN3O4S |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C18H25N3O4S.HI/c1-3-19-17(21-14-18(2,22)16-10-7-12-25-16)20-11-13-26(23,24)15-8-5-4-6-9-15;/h4-10,12,22H,3,11,13-14H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | XBBOMMZXVYXDDX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|