C19H33IN4O4 — CID 111999088
tert-butyl N-[2-[[N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111999088) has the molecular formula C19H33IN4O4 and a molecular weight of 508.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111999088 |
| Molecular Formula | C19H33IN4O4 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H32N4O4.HI/c1-6-20-17(21-10-11-22-18(25)27-19(2,3)4)23-13-16(24)14-8-7-9-15(12-14)26-5;/h7-9,12,16,24H,6,10-11,13H2,1-5H3,(H,22,25)(H2,20,21,23);1H |
| InChIKey | JXCJMXGKZDFXMN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|