C15H23F3IN3O2 — CID 109474662
1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474662) has the molecular formula C15H23F3IN3O2 and a molecular weight of 461.27 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474662 |
| Molecular Formula | C15H23F3IN3O2 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H22F3N3O2.HI/c1-3-19-14(20-8-7-15(16,17)18)21-10-13(22)11-5-4-6-12(9-11)23-2;/h4-6,9,13,22H,3,7-8,10H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | SFCHQBNDJCYTPG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|