C24H36IN3O4 — CID 109491423
1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109491423) has the molecular formula C24H36IN3O4 and a molecular weight of 557.47 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109491423 |
| Molecular Formula | C24H36IN3O4 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC(C)C)c1)NCCc1cc(OC)ccc1OC.I |
| InChI | InChI=1S/C24H35N3O4.HI/c1-6-25-24(26-13-12-19-15-20(29-4)10-11-23(19)30-5)27-16-22(28)18-8-7-9-21(14-18)31-17(2)3;/h7-11,14-15,17,22,28H,6,12-13,16H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | FLYISDAFSXXHIL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|