C18H30N4O4S — CID 111682974
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenoxy)propyl]guanidine (PubChem CID 111682974) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenoxy)propyl]guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111682974 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1OC)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C18H30N4O4S/c1-4-19-18(20-10-12-22-11-7-13-27(22,23)24)21-14-15(2)26-17-9-6-5-8-16(17)25-3/h5-6,8-9,15H,4,7,10-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | SDHLYJCEQQKBKR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|