C22H30N4O4 — CID 111989529
N-[2-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide (PubChem CID 111989529) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 111989529 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1OC)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C22H30N4O4/c1-4-23-22(25-14-13-24-21(28)17-9-5-6-10-18(17)27)26-15-16(2)30-20-12-8-7-11-19(20)29-3/h5-12,16,27H,4,13-15H2,1-3H3,(H,24,28)(H2,23,25,26) |
| InChIKey | SCIZTNCCAPOCJB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|