C21H30N4O4S — CID 111683358
1-ethyl-2-[2-(2-methoxyphenoxy)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111683358) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyphenoxy)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-methoxyphenoxy)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111683358 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyphenoxy)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1OC)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H30N4O4S/c1-4-23-21(24-14-13-17-9-11-18(12-10-17)30(22,26)27)25-15-16(2)29-20-8-6-5-7-19(20)28-3/h5-12,16H,4,13-15H2,1-3H3,(H2,22,26,27)(H2,23,24,25) |
| InChIKey | ZSSJEKWDRILHEN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|