C15H24N4O3S — CID 111216389
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111216389) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111216389 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)NCc1ccccc1OC |
| InChI | InChI=1S/C15H24N4O3S/c1-16-15(17-8-10-19-9-5-11-23(19,20)21)18-12-13-6-3-4-7-14(13)22-2/h3-4,6-7H,5,8-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | YJPRWLLMEHAATJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|