C19H33IN6 — CID 111761664
2-methyl-1-(6-methylheptan-2-yl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111761664) has the molecular formula C19H33IN6 and a molecular weight of 472.42 g/mol. Its IUPAC name is 2-methyl-1-(6-methylheptan-2-yl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(6-methylheptan-2-yl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111761664 |
| Molecular Formula | C19H33IN6 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-methyl-1-(6-methylheptan-2-yl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NC(C)CCCC(C)C.I |
| InChI | InChI=1S/C19H32N6.HI/c1-15(2)9-7-10-16(3)22-19(20-4)21-13-8-12-18-24-23-17-11-5-6-14-25(17)18;/h5-6,11,14-16H,7-10,12-13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | FGBWJLWKNHTHQE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|