C14H23IN6 — CID 111802991
2-(2-methylpropyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111802991) has the molecular formula C14H23IN6 and a molecular weight of 402.28 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylpropyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111802991 |
| Molecular Formula | C14H23IN6 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(2-methylpropyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(C)C/N=C(\N)NCCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C14H22N6.HI/c1-11(2)10-17-14(15)16-8-5-7-13-19-18-12-6-3-4-9-20(12)13;/h3-4,6,9,11H,5,7-8,10H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | LASLQWFIWWRRGS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|