C13H19IN6 — CID 111033934
2-(2-methylprop-2-enyl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111033934) has the molecular formula C13H19IN6 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033934 |
| Molecular Formula | C13H19IN6 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C13H18N6.HI/c1-10(2)9-16-13(14)15-7-6-12-18-17-11-5-3-4-8-19(11)12;/h3-5,8H,1,6-7,9H2,2H3,(H3,14,15,16);1H |
| InChIKey | GEYTXCOEGFGTTH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|