C17H28N6 — CID 111033881
1-(6-methylheptan-2-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111033881) has the molecular formula C17H28N6 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-(6-methylheptan-2-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-(6-methylheptan-2-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111033881 |
| Molecular Formula | C17H28N6 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 1-(6-methylheptan-2-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCc1nnc2ccccn12 |
| InChI | InChI=1S/C17H28N6/c1-13(2)7-6-8-14(3)20-17(18)19-11-10-16-22-21-15-9-4-5-12-23(15)16/h4-5,9,12-14H,6-8,10-11H2,1-3H3,(H3,18,19,20) |
| InChIKey | QQFAXXVEWRSUHU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|