C19H27IN6O — CID 111621081
1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111621081) has the molecular formula C19H27IN6O and a molecular weight of 482.37 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111621081 |
| Molecular Formula | C19H27IN6O |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1noc(C(C)(C)C)n1.I |
| InChI | InChI=1S/C19H26N6O.HI/c1-19(2,3)17-24-16(25-26-17)12-23-18(20-4)21-10-9-13-11-22-15-8-6-5-7-14(13)15;/h5-8,11,22H,9-10,12H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | WNSLCPQHAVEYFL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|