C21H24N6 — CID 154872497
1-[2-(1H-indazol-6-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 154872497) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-[2-(1H-indazol-6-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(1H-indazol-6-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 154872497 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-[2-(1H-indazol-6-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc2cn[nH]c2c1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H24N6/c1-22-21(23-10-8-15-6-7-17-14-26-27-20(17)12-15)24-11-9-16-13-25-19-5-3-2-4-18(16)19/h2-7,12-14,25H,8-11H2,1H3,(H,26,27)(H2,22,23,24) |
| InChIKey | KNAIESAXVJHFNK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|