C23H26FN5O3 — CID 111168361
N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111168361) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168361 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1coc(-c2ccc(F)cc2)n1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H26FN5O3/c1-2-25-23(29-13-11-28(12-14-29)22(30)20-4-3-15-31-20)26-10-9-19-16-32-21(27-19)17-5-7-18(24)8-6-17/h3-8,15-16H,2,9-14H2,1H3,(H,25,26) |
| InChIKey | MCJCJILBQWAPTR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|