C21H28FN5O2 — CID 111728203
N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111728203) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111728203 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1coc(-c2ccc(F)cc2)n1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C21H28FN5O2/c1-23-21(27-9-7-19(14-27)26-10-12-28-13-11-26)24-8-6-18-15-29-20(25-18)16-2-4-17(22)5-3-16/h2-5,15,19H,6-14H2,1H3,(H,23,24) |
| InChIKey | VAJJNHLLCRMUAW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|