C24H28FIN4OS — CID 111749496
N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111749496) has the molecular formula C24H28FIN4OS and a molecular weight of 566.48 g/mol. Its IUPAC name is N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111749496 |
| Molecular Formula | C24H28FIN4OS |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(F)cc2)n1)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C24H27FN4OS.HI/c1-26-24(29-14-12-18(15-29)17-31-22-5-3-2-4-6-22)27-13-11-21-16-30-23(28-21)19-7-9-20(25)10-8-19;/h2-10,16,18H,11-15,17H2,1H3,(H,26,27);1H |
| InChIKey | JBOILDSHCTZHKL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|