C18H29F2IN4 — CID 111965632
1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111965632) has the molecular formula C18H29F2IN4 and a molecular weight of 466.36 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111965632 |
| Molecular Formula | C18H29F2IN4 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN1CC)NCCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C18H28F2N4.HI/c1-3-21-18(23-13-16-6-5-11-24(16)4-2)22-10-9-14-12-15(19)7-8-17(14)20;/h7-8,12,16H,3-6,9-11,13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | RYUYNPFVDMAKFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|