C16H27N5OS — CID 111094419
N-[3-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111094419) has the molecular formula C16H27N5OS and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[3-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111094419 |
| Molecular Formula | C16H27N5OS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[3-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN1CCCC1C/N=C(\N)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H27N5OS/c1-2-21-10-3-6-13(21)12-20-16(17)19-9-5-8-18-15(22)14-7-4-11-23-14/h4,7,11,13H,2-3,5-6,8-10,12H2,1H3,(H,18,22)(H3,17,19,20) |
| InChIKey | YOGWOVJBMHTNNB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|