C18H25IN4O3S — CID 111043823
2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111043823) has the molecular formula C18H25IN4O3S and a molecular weight of 504.39 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043823 |
| Molecular Formula | C18H25IN4O3S |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CCNS(=O)(=O)c1cc(C)ccc1C.I |
| InChI | InChI=1S/C18H24N4O3S.HI/c1-13-8-9-14(2)17(12-13)26(23,24)21-11-10-20-18(19)22-15-6-4-5-7-16(15)25-3;/h4-9,12,21H,10-11H2,1-3H3,(H3,19,20,22);1H |
| InChIKey | UUKLFQVWZGVJEO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|