C15H26N4O2S — CID 75493953
2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine (PubChem CID 75493953) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 75493953 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCN=C(N(C)C)N(C)C)c1 |
| InChI | InChI=1S/C15H26N4O2S/c1-12-7-8-13(2)14(11-12)22(20,21)17-10-9-16-15(18(3)4)19(5)6/h7-8,11,17H,9-10H2,1-6H3 |
| InChIKey | WHMJURZIKJUZOS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|