C16H23IN4O2S2 — CID 119942646
2-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 119942646) has the molecular formula C16H23IN4O2S2 and a molecular weight of 494.42 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119942646 |
| Molecular Formula | C16H23IN4O2S2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CCNS(=O)(=O)c2cc(C)sc2C)c1.I |
| InChI | InChI=1S/C16H22N4O2S2.HI/c1-11-5-4-6-14(9-11)20-16(17)18-7-8-19-24(21,22)15-10-12(2)23-13(15)3;/h4-6,9-10,19H,7-8H2,1-3H3,(H3,17,18,20);1H |
| InChIKey | NRZPNPOOUQEEDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|