C17H21FN2O2S — CID 47620145
3-[[(3-fluorophenyl)methylamino]methyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 47620145) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-[[(3-fluorophenyl)methylamino]methyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-[[(3-fluorophenyl)methylamino]methyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 47620145 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-[[(3-fluorophenyl)methylamino]methyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(CNCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H21FN2O2S/c1-13(2)20-23(21,22)17-8-4-6-15(10-17)12-19-11-14-5-3-7-16(18)9-14/h3-10,13,19-20H,11-12H2,1-2H3 |
| InChIKey | GEZAIBNXYILKBQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |