C16H19BrN2O4S2 — CID 35395491
3-[[(4-bromophenyl)sulfonylamino]methyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 35395491) has the molecular formula C16H19BrN2O4S2 and a molecular weight of 447.38 g/mol. Its IUPAC name is 3-[[(4-bromophenyl)sulfonylamino]methyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-[[(4-bromophenyl)sulfonylamino]methyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 35395491 |
| Molecular Formula | C16H19BrN2O4S2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 3-[[(4-bromophenyl)sulfonylamino]methyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(CNS(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H19BrN2O4S2/c1-12(2)19-25(22,23)16-5-3-4-13(10-16)11-18-24(20,21)15-8-6-14(17)7-9-15/h3-10,12,18-19H,11H2,1-2H3 |
| InChIKey | UJVIBGYPUWBCOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |