C15H21BrIN3O2 — CID 111849859
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 111849859) has the molecular formula C15H21BrIN3O2 and a molecular weight of 482.16 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111849859 |
| Molecular Formula | C15H21BrIN3O2 |
| Molecular Weight | 482.16 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/Cc1cc(Br)c(OC)c(OC)c1)NCC.I |
| InChI | InChI=1S/C15H20BrN3O2.HI/c1-5-7-18-15(17-6-2)19-10-11-8-12(16)14(21-4)13(9-11)20-3;/h1,8-9H,6-7,10H2,2-4H3,(H2,17,18,19);1H |
| InChIKey | YDVATKLOXWQTAM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|