C18H24BrN3O2S — CID 111892995
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111892995) has the molecular formula C18H24BrN3O2S and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111892995 |
| Molecular Formula | C18H24BrN3O2S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)c(OC)c(OC)c1)NCc1sccc1C |
| InChI | InChI=1S/C18H24BrN3O2S/c1-5-20-18(22-11-16-12(2)6-7-25-16)21-10-13-8-14(19)17(24-4)15(9-13)23-3/h6-9H,5,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | BORIGUJDWOOVEX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|