C23H29IN4O3S — CID 111893050
2-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893050) has the molecular formula C23H29IN4O3S and a molecular weight of 568.48 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893050 |
| Molecular Formula | C23H29IN4O3S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 2-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Oc2c(OC)cccc2OC)nc1)NCc1sccc1C.I |
| InChI | InChI=1S/C23H28N4O3S.HI/c1-5-24-23(27-15-20-16(2)11-12-31-20)26-14-17-9-10-21(25-13-17)30-22-18(28-3)7-6-8-19(22)29-4;/h6-13H,5,14-15H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | UCGCBPJQRKIJIX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|