C20H34BrN3O3 — CID 111715590
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111715590) has the molecular formula C20H34BrN3O3 and a molecular weight of 444.41 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111715590 |
| Molecular Formula | C20H34BrN3O3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)c(OC)c(OC)c1)NCC(CCO)CC(C)C |
| InChI | InChI=1S/C20H34BrN3O3/c1-6-22-20(23-12-15(7-8-25)9-14(2)3)24-13-16-10-17(21)19(27-5)18(11-16)26-4/h10-11,14-15,25H,6-9,12-13H2,1-5H3,(H2,22,23,24) |
| InChIKey | SUIIRQHICQYZCB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|