C15H20ClN5 — CID 119118072
N'-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 119118072) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is N'-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119118072 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N'-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/Cc2cn3cc(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C15H20ClN5/c1-11-3-2-6-20(8-11)15(17)18-7-13-10-21-9-12(16)4-5-14(21)19-13/h4-5,9-11H,2-3,6-8H2,1H3,(H2,17,18) |
| InChIKey | JTDQTHKGVCOCRK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|