C17H24BrN5 — CID 111143706
N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide (PubChem CID 111143706) has the molecular formula C17H24BrN5 and a molecular weight of 378.32 g/mol. Its IUPAC name is N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111143706 |
| Molecular Formula | C17H24BrN5 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)N1CCCC(C)C1 |
| InChI | InChI=1S/C17H24BrN5/c1-3-19-17(22-8-4-5-13(2)10-22)20-9-15-12-23-11-14(18)6-7-16(23)21-15/h6-7,11-13H,3-5,8-10H2,1-2H3,(H,19,20) |
| InChIKey | XKPMEKKYLZRZEZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|