C15H21FN4 — CID 122096032
N'-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methyl]azetidine-1-carboximidamide (PubChem CID 122096032) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is N'-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122096032 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methyl]azetidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1c(F)cccc1N1CCCC1)N1CCC1 |
| InChI | InChI=1S/C15H21FN4/c16-13-5-3-6-14(19-7-1-2-8-19)12(13)11-18-15(17)20-9-4-10-20/h3,5-6H,1-2,4,7-11H2,(H2,17,18) |
| InChIKey | ASZGBQREXYKMNB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|