C13H19FN4 — CID 119164304
N'-[(5-fluoro-2-pyridinyl)methyl]azepane-1-carboximidamide (PubChem CID 119164304) has the molecular formula C13H19FN4 and a molecular weight of 250.32 g/mol. Its IUPAC name is N'-[(5-fluoro-2-pyridinyl)methyl]azepane-1-carboximidamide.
| Compound Name | N'-[(5-fluoro-2-pyridinyl)methyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 119164304 |
| Molecular Formula | C13H19FN4 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | N'-[(5-fluoro-2-pyridinyl)methyl]azepane-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(F)cn1)N1CCCCCC1 |
| InChI | InChI=1S/C13H19FN4/c14-11-5-6-12(16-9-11)10-17-13(15)18-7-3-1-2-4-8-18/h5-6,9H,1-4,7-8,10H2,(H2,15,17) |
| InChIKey | GGKKQRHTCNEEAJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|